C28H14F8 — CID 138468414
6-[2,6-difluoro-4-[(E)-2-(2-fluoro-4-methylphenyl)ethenyl]phenyl]-1,3-difluoro-2-(3,3,3-trifluoroprop-1-ynyl)naphthalene (PubChem CID 138468414) has the molecular formula C28H14F8 and a molecular weight of 502.40 g/mol. Its IUPAC name is 6-[2,6-difluoro-4-[(E)-2-(2-fluoro-4-methylphenyl)ethenyl]phenyl]-1,3-difluoro-2-(3,3,3-trifluoroprop-1-ynyl)naphthalene.
| Compound Name | 6-[2,6-difluoro-4-[(E)-2-(2-fluoro-4-methylphenyl)ethenyl]phenyl]-1,3-difluoro-2-(3,3,3-trifluoroprop-1-ynyl)naphthalene |
|---|---|
| PubChem CID | 138468414 |
| Molecular Formula | C28H14F8 |
| Molecular Weight | 502.40 g/mol |
| Exact Mass | 502.10 |
| IUPAC Name | 6-[2,6-difluoro-4-[(E)-2-(2-fluoro-4-methylphenyl)ethenyl]phenyl]-1,3-difluoro-2-(3,3,3-trifluoroprop-1-ynyl)naphthalene |
| SMILES | Cc1ccc(/C=C/c2cc(F)c(-c3ccc4c(F)c(C#CC(F)(F)F)c(F)cc4c3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C28H14F8/c1-15-2-4-17(22(29)10-15)5-3-16-11-24(31)26(25(32)12-16)18-6-7-20-19(13-18)14-23(30)21(27(20)33)8-9-28(34,35)36/h2-7,10-14H,1H3/b5-3+ |
| InChIKey | LSIDTICIHVUCMO-HWKANZROSA-N |
| XLogP | 8.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.40 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|