C25H18F5N — CID 138468334
2-[5,7-difluoro-6-(3,3,3-trifluoroprop-1-ynyl)naphthalen-2-yl]-5-(4-methylcyclohex-3-en-1-yl)pyridine (PubChem CID 138468334) has the molecular formula C25H18F5N and a molecular weight of 427.42 g/mol. Its IUPAC name is 2-[5,7-difluoro-6-(3,3,3-trifluoroprop-1-ynyl)naphthalen-2-yl]-5-(4-methylcyclohex-3-en-1-yl)pyridine.
| Compound Name | 2-[5,7-difluoro-6-(3,3,3-trifluoroprop-1-ynyl)naphthalen-2-yl]-5-(4-methylcyclohex-3-en-1-yl)pyridine |
|---|---|
| PubChem CID | 138468334 |
| Molecular Formula | C25H18F5N |
| Molecular Weight | 427.42 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 2-[5,7-difluoro-6-(3,3,3-trifluoroprop-1-ynyl)naphthalen-2-yl]-5-(4-methylcyclohex-3-en-1-yl)pyridine |
| SMILES | CC1=CCC(c2ccc(-c3ccc4c(F)c(C#CC(F)(F)F)c(F)cc4c3)nc2)CC1 |
| InChI | InChI=1S/C25H18F5N/c1-15-2-4-16(5-3-15)18-7-9-23(31-14-18)17-6-8-20-19(12-17)13-22(26)21(24(20)27)10-11-25(28,29)30/h2,6-9,12-14,16H,3-5H2,1H3 |
| InChIKey | VMNZONXVPFVFJA-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.42 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|