C26H17F5 — CID 138468605
1,3-difluoro-6-[2-(6-methyl-5,6,7,8-tetrahydronaphthalen-2-yl)ethynyl]-2-(3,3,3-trifluoroprop-1-ynyl)naphthalene (PubChem CID 138468605) has the molecular formula C26H17F5 and a molecular weight of 424.41 g/mol. Its IUPAC name is 1,3-difluoro-6-[2-(6-methyl-5,6,7,8-tetrahydronaphthalen-2-yl)ethynyl]-2-(3,3,3-trifluoroprop-1-ynyl)naphthalene.
| Compound Name | 1,3-difluoro-6-[2-(6-methyl-5,6,7,8-tetrahydronaphthalen-2-yl)ethynyl]-2-(3,3,3-trifluoroprop-1-ynyl)naphthalene |
|---|---|
| PubChem CID | 138468605 |
| Molecular Formula | C26H17F5 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | 1,3-difluoro-6-[2-(6-methyl-5,6,7,8-tetrahydronaphthalen-2-yl)ethynyl]-2-(3,3,3-trifluoroprop-1-ynyl)naphthalene |
| SMILES | CC1CCc2cc(C#Cc3ccc4c(F)c(C#CC(F)(F)F)c(F)cc4c3)ccc2C1 |
| InChI | InChI=1S/C26H17F5/c1-16-2-7-20-13-17(5-8-19(20)12-16)3-4-18-6-9-22-21(14-18)15-24(27)23(25(22)28)10-11-26(29,30)31/h5-6,8-9,13-16H,2,7,12H2,1H3 |
| InChIKey | DZXKOEJHYRJGRE-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|