C20H8F5N — CID 138459115
2-[2-[5,7-difluoro-6-(3,3,3-trifluoroprop-1-ynyl)naphthalen-2-yl]ethynyl]pyridine (PubChem CID 138459115) has the molecular formula C20H8F5N and a molecular weight of 357.28 g/mol. Its IUPAC name is 2-[2-[5,7-difluoro-6-(3,3,3-trifluoroprop-1-ynyl)naphthalen-2-yl]ethynyl]pyridine.
| Compound Name | 2-[2-[5,7-difluoro-6-(3,3,3-trifluoroprop-1-ynyl)naphthalen-2-yl]ethynyl]pyridine |
|---|---|
| PubChem CID | 138459115 |
| Molecular Formula | C20H8F5N |
| Molecular Weight | 357.28 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | 2-[2-[5,7-difluoro-6-(3,3,3-trifluoroprop-1-ynyl)naphthalen-2-yl]ethynyl]pyridine |
| SMILES | Fc1cc2cc(C#Cc3ccccn3)ccc2c(F)c1C#CC(F)(F)F |
| InChI | InChI=1S/C20H8F5N/c21-18-12-14-11-13(4-6-15-3-1-2-10-26-15)5-7-16(14)19(22)17(18)8-9-20(23,24)25/h1-3,5,7,10-12H |
| InChIKey | KGLIIPYNCQMOGJ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.28 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|