C31H23F7O — CID 145389485
6-[2-[4-(4-butoxyphenyl)-2,6-difluorophenyl]ethyl]-1,3-difluoro-2-(3,3,3-trifluoroprop-1-ynyl)naphthalene (PubChem CID 145389485) has the molecular formula C31H23F7O and a molecular weight of 544.51 g/mol. Its IUPAC name is 6-[2-[4-(4-butoxyphenyl)-2,6-difluorophenyl]ethyl]-1,3-difluoro-2-(3,3,3-trifluoroprop-1-ynyl)naphthalene.
| Compound Name | 6-[2-[4-(4-butoxyphenyl)-2,6-difluorophenyl]ethyl]-1,3-difluoro-2-(3,3,3-trifluoroprop-1-ynyl)naphthalene |
|---|---|
| PubChem CID | 145389485 |
| Molecular Formula | C31H23F7O |
| Molecular Weight | 544.51 g/mol |
| Exact Mass | 544.16 |
| IUPAC Name | 6-[2-[4-(4-butoxyphenyl)-2,6-difluorophenyl]ethyl]-1,3-difluoro-2-(3,3,3-trifluoroprop-1-ynyl)naphthalene |
| SMILES | CCCCOc1ccc(-c2cc(F)c(CCc3ccc4c(F)c(C#CC(F)(F)F)c(F)cc4c3)c(F)c2)cc1 |
| InChI | InChI=1S/C31H23F7O/c1-2-3-14-39-23-8-6-20(7-9-23)21-16-27(32)25(28(33)17-21)11-5-19-4-10-24-22(15-19)18-29(34)26(30(24)35)12-13-31(36,37)38/h4,6-10,15-18H,2-3,5,11,14H2,1H3 |
| InChIKey | OAGIFAOQSMXCLY-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.51 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|