C24H21F7 — CID 139856361
6-[2-(2,6-difluoro-4-pentylphenyl)ethyl]-1,3-difluoro-2-(trifluoromethyl)naphthalene (PubChem CID 139856361) has the molecular formula C24H21F7 and a molecular weight of 442.42 g/mol. Its IUPAC name is 6-[2-(2,6-difluoro-4-pentylphenyl)ethyl]-1,3-difluoro-2-(trifluoromethyl)naphthalene.
| Compound Name | 6-[2-(2,6-difluoro-4-pentylphenyl)ethyl]-1,3-difluoro-2-(trifluoromethyl)naphthalene |
|---|---|
| PubChem CID | 139856361 |
| Molecular Formula | C24H21F7 |
| Molecular Weight | 442.42 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | 6-[2-(2,6-difluoro-4-pentylphenyl)ethyl]-1,3-difluoro-2-(trifluoromethyl)naphthalene |
| SMILES | CCCCCc1cc(F)c(CCc2ccc3c(F)c(C(F)(F)F)c(F)cc3c2)c(F)c1 |
| InChI | InChI=1S/C24H21F7/c1-2-3-4-5-15-11-19(25)18(20(26)12-15)9-7-14-6-8-17-16(10-14)13-21(27)22(23(17)28)24(29,30)31/h6,8,10-13H,2-5,7,9H2,1H3 |
| InChIKey | UIDUUIOSZGZELT-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.42 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|