C27H28F6O — CID 139855843
6-[2-(2,6-difluoro-4-heptylphenyl)ethyl]-1-fluoro-2-(2,2,2-trifluoroethoxy)naphthalene (PubChem CID 139855843) has the molecular formula C27H28F6O and a molecular weight of 482.51 g/mol. Its IUPAC name is 6-[2-(2,6-difluoro-4-heptylphenyl)ethyl]-1-fluoro-2-(2,2,2-trifluoroethoxy)naphthalene.
| Compound Name | 6-[2-(2,6-difluoro-4-heptylphenyl)ethyl]-1-fluoro-2-(2,2,2-trifluoroethoxy)naphthalene |
|---|---|
| PubChem CID | 139855843 |
| Molecular Formula | C27H28F6O |
| Molecular Weight | 482.51 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | 6-[2-(2,6-difluoro-4-heptylphenyl)ethyl]-1-fluoro-2-(2,2,2-trifluoroethoxy)naphthalene |
| SMILES | CCCCCCCc1cc(F)c(CCc2ccc3c(F)c(OCC(F)(F)F)ccc3c2)c(F)c1 |
| InChI | InChI=1S/C27H28F6O/c1-2-3-4-5-6-7-19-15-23(28)22(24(29)16-19)12-9-18-8-11-21-20(14-18)10-13-25(26(21)30)34-17-27(31,32)33/h8,10-11,13-16H,2-7,9,12,17H2,1H3 |
| InChIKey | PAGNHNOXONLZCM-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.51 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|