C25H11F7 — CID 138458918
6-[(E)-1,2-difluoro-2-naphthalen-2-ylethenyl]-1,3-difluoro-2-(3,3,3-trifluoroprop-1-ynyl)naphthalene (PubChem CID 138458918) has the molecular formula C25H11F7 and a molecular weight of 444.35 g/mol. Its IUPAC name is 6-[(E)-1,2-difluoro-2-naphthalen-2-ylethenyl]-1,3-difluoro-2-(3,3,3-trifluoroprop-1-ynyl)naphthalene.
| Compound Name | 6-[(E)-1,2-difluoro-2-naphthalen-2-ylethenyl]-1,3-difluoro-2-(3,3,3-trifluoroprop-1-ynyl)naphthalene |
|---|---|
| PubChem CID | 138458918 |
| Molecular Formula | C25H11F7 |
| Molecular Weight | 444.35 g/mol |
| Exact Mass | 444.07 |
| IUPAC Name | 6-[(E)-1,2-difluoro-2-naphthalen-2-ylethenyl]-1,3-difluoro-2-(3,3,3-trifluoroprop-1-ynyl)naphthalene |
| SMILES | F/C(=C(/F)c1ccc2c(F)c(C#CC(F)(F)F)c(F)cc2c1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C25H11F7/c26-21-13-18-12-17(7-8-19(18)24(29)20(21)9-10-25(30,31)32)23(28)22(27)16-6-5-14-3-1-2-4-15(14)11-16/h1-8,11-13H/b23-22+ |
| InChIKey | RCCHVVWPVOFXBP-GHVJWSGMSA-N |
| XLogP | 7.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.35 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|