C26H23F7O4 — CID 138458220
1-[[5,7-difluoro-6-(3,3,3-trifluoroprop-1-ynyl)naphthalen-2-yl]oxy-difluoromethyl]-4-(4-methylcyclohexyl)-2,6,7-trioxabicyclo[2.2.2]octane (PubChem CID 138458220) has the molecular formula C26H23F7O4 and a molecular weight of 532.45 g/mol. Its IUPAC name is 1-[[5,7-difluoro-6-(3,3,3-trifluoroprop-1-ynyl)naphthalen-2-yl]oxy-difluoromethyl]-4-(4-methylcyclohexyl)-2,6,7-trioxabicyclo[2.2.2]octane.
| Compound Name | 1-[[5,7-difluoro-6-(3,3,3-trifluoroprop-1-ynyl)naphthalen-2-yl]oxy-difluoromethyl]-4-(4-methylcyclohexyl)-2,6,7-trioxabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 138458220 |
| Molecular Formula | C26H23F7O4 |
| Molecular Weight | 532.45 g/mol |
| Exact Mass | 532.15 |
| IUPAC Name | 1-[[5,7-difluoro-6-(3,3,3-trifluoroprop-1-ynyl)naphthalen-2-yl]oxy-difluoromethyl]-4-(4-methylcyclohexyl)-2,6,7-trioxabicyclo[2.2.2]octane |
| SMILES | CC1CCC(C23COC(C(F)(F)Oc4ccc5c(F)c(C#CC(F)(F)F)c(F)cc5c4)(OC2)OC3)CC1 |
| InChI | InChI=1S/C26H23F7O4/c1-15-2-4-17(5-3-15)23-12-34-26(35-13-23,36-14-23)25(32,33)37-18-6-7-19-16(10-18)11-21(27)20(22(19)28)8-9-24(29,30)31/h6-7,10-11,15,17H,2-5,12-14H2,1H3 |
| InChIKey | QHRKAPYELGHYPR-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.45 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|