C30H21F7O4 — CID 145389430
1,3-difluoro-6-methoxy-2-(3,3,3-trifluoroprop-1-ynyl)naphthalene;1,3-difluoro-6-(5-methyl-1,3-dioxan-2-yl)naphthalene-2-carbaldehyde (PubChem CID 145389430) has the molecular formula C30H21F7O4 and a molecular weight of 578.48 g/mol. Its IUPAC name is 1,3-difluoro-6-methoxy-2-(3,3,3-trifluoroprop-1-ynyl)naphthalene;1,3-difluoro-6-(5-methyl-1,3-dioxan-2-yl)naphthalene-2-carbaldehyde.
| Compound Name | 1,3-difluoro-6-methoxy-2-(3,3,3-trifluoroprop-1-ynyl)naphthalene;1,3-difluoro-6-(5-methyl-1,3-dioxan-2-yl)naphthalene-2-carbaldehyde |
|---|---|
| PubChem CID | 145389430 |
| Molecular Formula | C30H21F7O4 |
| Molecular Weight | 578.48 g/mol |
| Exact Mass | 578.13 |
| IUPAC Name | 1,3-difluoro-6-methoxy-2-(3,3,3-trifluoroprop-1-ynyl)naphthalene;1,3-difluoro-6-(5-methyl-1,3-dioxan-2-yl)naphthalene-2-carbaldehyde |
| SMILES | CC1COC(c2ccc3c(F)c(C=O)c(F)cc3c2)OC1.COc1ccc2c(F)c(C#CC(F)(F)F)c(F)cc2c1 |
| InChI | InChI=1S/C16H14F2O3.C14H7F5O/c1-9-7-20-16(21-8-9)10-2-3-12-11(4-10)5-14(17)13(6-19)15(12)18;1-20-9-2-3-10-8(6-9)7-12(15)11(13(10)16)4-5-14(17,18)19/h2-6,9,16H,7-8H2,1H3;2-3,6-7H,1H3 |
| InChIKey | OUQFPVGPKHZXPY-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.48 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|