C20H13F7 — CID 143726931
6-[3,5-difluoro-4-(3,3,3-trifluoroprop-1-ynyl)phenyl]-5,7-difluoro-2-methyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 143726931) has the molecular formula C20H13F7 and a molecular weight of 386.31 g/mol. Its IUPAC name is 6-[3,5-difluoro-4-(3,3,3-trifluoroprop-1-ynyl)phenyl]-5,7-difluoro-2-methyl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 6-[3,5-difluoro-4-(3,3,3-trifluoroprop-1-ynyl)phenyl]-5,7-difluoro-2-methyl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 143726931 |
| Molecular Formula | C20H13F7 |
| Molecular Weight | 386.31 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | 6-[3,5-difluoro-4-(3,3,3-trifluoroprop-1-ynyl)phenyl]-5,7-difluoro-2-methyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | CC1CCc2c(cc(F)c(-c3cc(F)c(C#CC(F)(F)F)c(F)c3)c2F)C1 |
| InChI | InChI=1S/C20H13F7/c1-10-2-3-13-11(6-10)7-17(23)18(19(13)24)12-8-15(21)14(16(22)9-12)4-5-20(25,26)27/h7-10H,2-3,6H2,1H3 |
| InChIKey | INARDIXTTJLPLP-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.31 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|