C25H21F5 — CID 139852100
6-(3,4-difluorophenyl)-5,7-difluoro-2-(2-fluoro-4-propylphenyl)-1,2,3,4-tetrahydronaphthalene (PubChem CID 139852100) has the molecular formula C25H21F5 and a molecular weight of 416.43 g/mol. Its IUPAC name is 6-(3,4-difluorophenyl)-5,7-difluoro-2-(2-fluoro-4-propylphenyl)-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 6-(3,4-difluorophenyl)-5,7-difluoro-2-(2-fluoro-4-propylphenyl)-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 139852100 |
| Molecular Formula | C25H21F5 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 6-(3,4-difluorophenyl)-5,7-difluoro-2-(2-fluoro-4-propylphenyl)-1,2,3,4-tetrahydronaphthalene |
| SMILES | CCCc1ccc(C2CCc3c(cc(F)c(-c4ccc(F)c(F)c4)c3F)C2)c(F)c1 |
| InChI | InChI=1S/C25H21F5/c1-2-3-14-4-7-18(21(27)10-14)15-5-8-19-17(11-15)13-23(29)24(25(19)30)16-6-9-20(26)22(28)12-16/h4,6-7,9-10,12-13,15H,2-3,5,8,11H2,1H3 |
| InChIKey | JDIPDMJCIGSQNT-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |