C26H21F7 — CID 139853695
2-(4-butyl-2-fluorophenyl)-5,7,8-trifluoro-6-(3,4,5-trifluorophenyl)-1,2,3,4-tetrahydronaphthalene (PubChem CID 139853695) has the molecular formula C26H21F7 and a molecular weight of 466.44 g/mol. Its IUPAC name is 2-(4-butyl-2-fluorophenyl)-5,7,8-trifluoro-6-(3,4,5-trifluorophenyl)-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 2-(4-butyl-2-fluorophenyl)-5,7,8-trifluoro-6-(3,4,5-trifluorophenyl)-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 139853695 |
| Molecular Formula | C26H21F7 |
| Molecular Weight | 466.44 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | 2-(4-butyl-2-fluorophenyl)-5,7,8-trifluoro-6-(3,4,5-trifluorophenyl)-1,2,3,4-tetrahydronaphthalene |
| SMILES | CCCCc1ccc(C2CCc3c(F)c(-c4cc(F)c(F)c(F)c4)c(F)c(F)c3C2)c(F)c1 |
| InChI | InChI=1S/C26H21F7/c1-2-3-4-13-5-7-16(19(27)9-13)14-6-8-17-18(10-14)24(31)26(33)22(23(17)30)15-11-20(28)25(32)21(29)12-15/h5,7,9,11-12,14H,2-4,6,8,10H2,1H3 |
| InChIKey | HJVRLMUNIBOMHW-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.44 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|