C27H23F7 — CID 139853393
2-(2,6-difluoro-4-pentylphenyl)-5,7-difluoro-6-(3,4,5-trifluorophenyl)-1,2,3,4-tetrahydronaphthalene (PubChem CID 139853393) has the molecular formula C27H23F7 and a molecular weight of 480.47 g/mol. Its IUPAC name is 2-(2,6-difluoro-4-pentylphenyl)-5,7-difluoro-6-(3,4,5-trifluorophenyl)-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 2-(2,6-difluoro-4-pentylphenyl)-5,7-difluoro-6-(3,4,5-trifluorophenyl)-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 139853393 |
| Molecular Formula | C27H23F7 |
| Molecular Weight | 480.47 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | 2-(2,6-difluoro-4-pentylphenyl)-5,7-difluoro-6-(3,4,5-trifluorophenyl)-1,2,3,4-tetrahydronaphthalene |
| SMILES | CCCCCc1cc(F)c(C2CCc3c(cc(F)c(-c4cc(F)c(F)c(F)c4)c3F)C2)c(F)c1 |
| InChI | InChI=1S/C27H23F7/c1-2-3-4-5-14-8-19(28)24(20(29)9-14)15-6-7-18-16(10-15)11-21(30)25(26(18)33)17-12-22(31)27(34)23(32)13-17/h8-9,11-13,15H,2-7,10H2,1H3 |
| InChIKey | JMQRCZSRIVPRHI-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.47 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|