C24H26F3N — CID 139848050
6-(2,6-difluoro-4-heptylphenyl)-1-fluoro-5,6,7,8-tetrahydronaphthalene-2-carbonitrile (PubChem CID 139848050) has the molecular formula C24H26F3N and a molecular weight of 385.47 g/mol. Its IUPAC name is 6-(2,6-difluoro-4-heptylphenyl)-1-fluoro-5,6,7,8-tetrahydronaphthalene-2-carbonitrile.
| Compound Name | 6-(2,6-difluoro-4-heptylphenyl)-1-fluoro-5,6,7,8-tetrahydronaphthalene-2-carbonitrile |
|---|---|
| PubChem CID | 139848050 |
| Molecular Formula | C24H26F3N |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | 6-(2,6-difluoro-4-heptylphenyl)-1-fluoro-5,6,7,8-tetrahydronaphthalene-2-carbonitrile |
| SMILES | CCCCCCCc1cc(F)c(C2CCc3c(ccc(C#N)c3F)C2)c(F)c1 |
| InChI | InChI=1S/C24H26F3N/c1-2-3-4-5-6-7-16-12-21(25)23(22(26)13-16)18-10-11-20-17(14-18)8-9-19(15-28)24(20)27/h8-9,12-13,18H,2-7,10-11,14H2,1H3 |
| InChIKey | ZURMLJMZQARADS-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|