C25H28F3N — CID 139848684
6-[2-(2,6-difluoro-4-hexylphenyl)ethyl]-1-fluoro-5,6,7,8-tetrahydronaphthalene-2-carbonitrile (PubChem CID 139848684) has the molecular formula C25H28F3N and a molecular weight of 399.50 g/mol. Its IUPAC name is 6-[2-(2,6-difluoro-4-hexylphenyl)ethyl]-1-fluoro-5,6,7,8-tetrahydronaphthalene-2-carbonitrile.
| Compound Name | 6-[2-(2,6-difluoro-4-hexylphenyl)ethyl]-1-fluoro-5,6,7,8-tetrahydronaphthalene-2-carbonitrile |
|---|---|
| PubChem CID | 139848684 |
| Molecular Formula | C25H28F3N |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | 6-[2-(2,6-difluoro-4-hexylphenyl)ethyl]-1-fluoro-5,6,7,8-tetrahydronaphthalene-2-carbonitrile |
| SMILES | CCCCCCc1cc(F)c(CCC2CCc3c(ccc(C#N)c3F)C2)c(F)c1 |
| InChI | InChI=1S/C25H28F3N/c1-2-3-4-5-6-18-14-23(26)22(24(27)15-18)12-8-17-7-11-21-19(13-17)9-10-20(16-29)25(21)28/h9-10,14-15,17H,2-8,11-13H2,1H3 |
| InChIKey | FRCITTYTASAGTI-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|