C24H25F4N — CID 139848507
6-[2-(2,6-difluoro-4-pentylphenyl)ethyl]-1,3-difluoro-5,6,7,8-tetrahydronaphthalene-2-carbonitrile (PubChem CID 139848507) has the molecular formula C24H25F4N and a molecular weight of 403.46 g/mol. Its IUPAC name is 6-[2-(2,6-difluoro-4-pentylphenyl)ethyl]-1,3-difluoro-5,6,7,8-tetrahydronaphthalene-2-carbonitrile.
| Compound Name | 6-[2-(2,6-difluoro-4-pentylphenyl)ethyl]-1,3-difluoro-5,6,7,8-tetrahydronaphthalene-2-carbonitrile |
|---|---|
| PubChem CID | 139848507 |
| Molecular Formula | C24H25F4N |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 6-[2-(2,6-difluoro-4-pentylphenyl)ethyl]-1,3-difluoro-5,6,7,8-tetrahydronaphthalene-2-carbonitrile |
| SMILES | CCCCCc1cc(F)c(CCC2CCc3c(cc(F)c(C#N)c3F)C2)c(F)c1 |
| InChI | InChI=1S/C24H25F4N/c1-2-3-4-5-16-11-21(25)19(22(26)12-16)9-7-15-6-8-18-17(10-15)13-23(27)20(14-29)24(18)28/h11-13,15H,2-10H2,1H3 |
| InChIKey | MFJMEASEUKTPKQ-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|