C36H38F5N — CID 139852194
2,6-difluoro-4-[4-[1,3,4-trifluoro-6-[2-(4-pentylphenyl)ethyl]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclohexyl]benzonitrile (PubChem CID 139852194) has the molecular formula C36H38F5N and a molecular weight of 579.70 g/mol. Its IUPAC name is 2,6-difluoro-4-[4-[1,3,4-trifluoro-6-[2-(4-pentylphenyl)ethyl]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclohexyl]benzonitrile.
| Compound Name | 2,6-difluoro-4-[4-[1,3,4-trifluoro-6-[2-(4-pentylphenyl)ethyl]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclohexyl]benzonitrile |
|---|---|
| PubChem CID | 139852194 |
| Molecular Formula | C36H38F5N |
| Molecular Weight | 579.70 g/mol |
| Exact Mass | 579.29 |
| IUPAC Name | 2,6-difluoro-4-[4-[1,3,4-trifluoro-6-[2-(4-pentylphenyl)ethyl]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclohexyl]benzonitrile |
| SMILES | CCCCCc1ccc(CCC2CCc3c(F)c(C4CCC(c5cc(F)c(C#N)c(F)c5)CC4)c(F)c(F)c3C2)cc1 |
| InChI | InChI=1S/C36H38F5N/c1-2-3-4-5-22-6-8-23(9-7-22)10-11-24-12-17-28-29(18-24)35(40)36(41)33(34(28)39)26-15-13-25(14-16-26)27-19-31(37)30(21-42)32(38)20-27/h6-9,19-20,24-26H,2-5,10-18H2,1H3 |
| InChIKey | RVOLNBMPTJJNHI-UHFFFAOYSA-N |
| XLogP | 10.17 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.70 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|