C34H34F5N — CID 139853656
4-[4-[6-[2-(2,6-difluoro-4-propylphenyl)ethyl]-1,3,4-trifluoro-5,6,7,8-tetrahydronaphthalen-2-yl]cyclohexyl]benzonitrile (PubChem CID 139853656) has the molecular formula C34H34F5N and a molecular weight of 551.64 g/mol. Its IUPAC name is 4-[4-[6-[2-(2,6-difluoro-4-propylphenyl)ethyl]-1,3,4-trifluoro-5,6,7,8-tetrahydronaphthalen-2-yl]cyclohexyl]benzonitrile.
| Compound Name | 4-[4-[6-[2-(2,6-difluoro-4-propylphenyl)ethyl]-1,3,4-trifluoro-5,6,7,8-tetrahydronaphthalen-2-yl]cyclohexyl]benzonitrile |
|---|---|
| PubChem CID | 139853656 |
| Molecular Formula | C34H34F5N |
| Molecular Weight | 551.64 g/mol |
| Exact Mass | 551.26 |
| IUPAC Name | 4-[4-[6-[2-(2,6-difluoro-4-propylphenyl)ethyl]-1,3,4-trifluoro-5,6,7,8-tetrahydronaphthalen-2-yl]cyclohexyl]benzonitrile |
| SMILES | CCCc1cc(F)c(CCC2CCc3c(F)c(C4CCC(c5ccc(C#N)cc5)CC4)c(F)c(F)c3C2)c(F)c1 |
| InChI | InChI=1S/C34H34F5N/c1-2-3-22-17-29(35)27(30(36)18-22)15-7-20-6-14-26-28(16-20)33(38)34(39)31(32(26)37)25-12-10-24(11-13-25)23-8-4-21(19-40)5-9-23/h4-5,8-9,17-18,20,24-25H,2-3,6-7,10-16H2,1H3 |
| InChIKey | TYVXGMONHZGWKR-UHFFFAOYSA-N |
| XLogP | 9.39 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.64 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|