C33H32F5N — CID 139852719
4-[4-[6-[2-(4-ethylphenyl)ethyl]-1,3,4-trifluoro-5,6,7,8-tetrahydronaphthalen-2-yl]cyclohexyl]-2,6-difluorobenzonitrile (PubChem CID 139852719) has the molecular formula C33H32F5N and a molecular weight of 537.62 g/mol. Its IUPAC name is 4-[4-[6-[2-(4-ethylphenyl)ethyl]-1,3,4-trifluoro-5,6,7,8-tetrahydronaphthalen-2-yl]cyclohexyl]-2,6-difluorobenzonitrile.
| Compound Name | 4-[4-[6-[2-(4-ethylphenyl)ethyl]-1,3,4-trifluoro-5,6,7,8-tetrahydronaphthalen-2-yl]cyclohexyl]-2,6-difluorobenzonitrile |
|---|---|
| PubChem CID | 139852719 |
| Molecular Formula | C33H32F5N |
| Molecular Weight | 537.62 g/mol |
| Exact Mass | 537.25 |
| IUPAC Name | 4-[4-[6-[2-(4-ethylphenyl)ethyl]-1,3,4-trifluoro-5,6,7,8-tetrahydronaphthalen-2-yl]cyclohexyl]-2,6-difluorobenzonitrile |
| SMILES | CCc1ccc(CCC2CCc3c(F)c(C4CCC(c5cc(F)c(C#N)c(F)c5)CC4)c(F)c(F)c3C2)cc1 |
| InChI | InChI=1S/C33H32F5N/c1-2-19-3-5-20(6-4-19)7-8-21-9-14-25-26(15-21)32(37)33(38)30(31(25)36)23-12-10-22(11-13-23)24-16-28(34)27(18-39)29(35)17-24/h3-6,16-17,21-23H,2,7-15H2,1H3 |
| InChIKey | JDWIBISTWOXTBO-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.62 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|