C35H36F8O — CID 139852612
2-[2-(4-butyl-2-fluorophenyl)ethyl]-5,7,8-trifluoro-6-[4-[3-fluoro-4-(trifluoromethoxy)phenyl]cyclohexyl]-1,2,3,4-tetrahydronaphthalene (PubChem CID 139852612) has the molecular formula C35H36F8O and a molecular weight of 624.66 g/mol. Its IUPAC name is 2-[2-(4-butyl-2-fluorophenyl)ethyl]-5,7,8-trifluoro-6-[4-[3-fluoro-4-(trifluoromethoxy)phenyl]cyclohexyl]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 2-[2-(4-butyl-2-fluorophenyl)ethyl]-5,7,8-trifluoro-6-[4-[3-fluoro-4-(trifluoromethoxy)phenyl]cyclohexyl]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 139852612 |
| Molecular Formula | C35H36F8O |
| Molecular Weight | 624.66 g/mol |
| Exact Mass | 624.26 |
| IUPAC Name | 2-[2-(4-butyl-2-fluorophenyl)ethyl]-5,7,8-trifluoro-6-[4-[3-fluoro-4-(trifluoromethoxy)phenyl]cyclohexyl]-1,2,3,4-tetrahydronaphthalene |
| SMILES | CCCCc1ccc(CCC2CCc3c(F)c(C4CCC(c5ccc(OC(F)(F)F)c(F)c5)CC4)c(F)c(F)c3C2)c(F)c1 |
| InChI | InChI=1S/C35H36F8O/c1-2-3-4-20-5-8-23(28(36)18-20)9-6-21-7-15-26-27(17-21)33(39)34(40)31(32(26)38)24-12-10-22(11-13-24)25-14-16-30(29(37)19-25)44-35(41,42)43/h5,8,14,16,18-19,21-22,24H,2-4,6-7,9-13,15,17H2,1H3 |
| InChIKey | TZLWXDKXNSSNSJ-UHFFFAOYSA-N |
| XLogP | 10.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.66 |
| LogP ≤ 5 | 10.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|