C34H34F8O — CID 139853514
2-[2-(2,3-difluoro-4-propylphenyl)ethyl]-5,7-difluoro-6-[4-[3-fluoro-4-(trifluoromethoxy)phenyl]cyclohexyl]-1,2,3,4-tetrahydronaphthalene (PubChem CID 139853514) has the molecular formula C34H34F8O and a molecular weight of 610.63 g/mol. Its IUPAC name is 2-[2-(2,3-difluoro-4-propylphenyl)ethyl]-5,7-difluoro-6-[4-[3-fluoro-4-(trifluoromethoxy)phenyl]cyclohexyl]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 2-[2-(2,3-difluoro-4-propylphenyl)ethyl]-5,7-difluoro-6-[4-[3-fluoro-4-(trifluoromethoxy)phenyl]cyclohexyl]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 139853514 |
| Molecular Formula | C34H34F8O |
| Molecular Weight | 610.63 g/mol |
| Exact Mass | 610.25 |
| IUPAC Name | 2-[2-(2,3-difluoro-4-propylphenyl)ethyl]-5,7-difluoro-6-[4-[3-fluoro-4-(trifluoromethoxy)phenyl]cyclohexyl]-1,2,3,4-tetrahydronaphthalene |
| SMILES | CCCc1ccc(CCC2CCc3c(cc(F)c(C4CCC(c5ccc(OC(F)(F)F)c(F)c5)CC4)c3F)C2)c(F)c1F |
| InChI | InChI=1S/C34H34F8O/c1-2-3-22-11-12-23(32(38)31(22)37)6-4-19-5-14-26-25(16-19)18-28(36)30(33(26)39)21-9-7-20(8-10-21)24-13-15-29(27(35)17-24)43-34(40,41)42/h11-13,15,17-21H,2-10,14,16H2,1H3 |
| InChIKey | UDOMGEUVSOKPNO-UHFFFAOYSA-N |
| XLogP | 10.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.63 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |