C34H35F7O — CID 139852423
5,7,8-trifluoro-6-[4-[3-fluoro-4-(trifluoromethoxy)phenyl]cyclohexyl]-2-[2-(4-propylphenyl)ethyl]-1,2,3,4-tetrahydronaphthalene (PubChem CID 139852423) has the molecular formula C34H35F7O and a molecular weight of 592.64 g/mol. Its IUPAC name is 5,7,8-trifluoro-6-[4-[3-fluoro-4-(trifluoromethoxy)phenyl]cyclohexyl]-2-[2-(4-propylphenyl)ethyl]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 5,7,8-trifluoro-6-[4-[3-fluoro-4-(trifluoromethoxy)phenyl]cyclohexyl]-2-[2-(4-propylphenyl)ethyl]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 139852423 |
| Molecular Formula | C34H35F7O |
| Molecular Weight | 592.64 g/mol |
| Exact Mass | 592.26 |
| IUPAC Name | 5,7,8-trifluoro-6-[4-[3-fluoro-4-(trifluoromethoxy)phenyl]cyclohexyl]-2-[2-(4-propylphenyl)ethyl]-1,2,3,4-tetrahydronaphthalene |
| SMILES | CCCc1ccc(CCC2CCc3c(F)c(C4CCC(c5ccc(OC(F)(F)F)c(F)c5)CC4)c(F)c(F)c3C2)cc1 |
| InChI | InChI=1S/C34H35F7O/c1-2-3-20-4-6-21(7-5-20)8-9-22-10-16-26-27(18-22)32(37)33(38)30(31(26)36)24-13-11-23(12-14-24)25-15-17-29(28(35)19-25)42-34(39,40)41/h4-7,15,17,19,22-24H,2-3,8-14,16,18H2,1H3 |
| InChIKey | QUQJEFPWRVFYEL-UHFFFAOYSA-N |
| XLogP | 10.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.64 |
| LogP ≤ 5 | 10.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|