C35H34F10O — CID 139852703
2-[2-(4-butyl-2,3-difluorophenyl)ethyl]-6-[4-[2,3-difluoro-4-(trifluoromethoxy)phenyl]cyclohexyl]-5,7,8-trifluoro-1,2,3,4-tetrahydronaphthalene (PubChem CID 139852703) has the molecular formula C35H34F10O and a molecular weight of 660.64 g/mol. Its IUPAC name is 2-[2-(4-butyl-2,3-difluorophenyl)ethyl]-6-[4-[2,3-difluoro-4-(trifluoromethoxy)phenyl]cyclohexyl]-5,7,8-trifluoro-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 2-[2-(4-butyl-2,3-difluorophenyl)ethyl]-6-[4-[2,3-difluoro-4-(trifluoromethoxy)phenyl]cyclohexyl]-5,7,8-trifluoro-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 139852703 |
| Molecular Formula | C35H34F10O |
| Molecular Weight | 660.64 g/mol |
| Exact Mass | 660.24 |
| IUPAC Name | 2-[2-(4-butyl-2,3-difluorophenyl)ethyl]-6-[4-[2,3-difluoro-4-(trifluoromethoxy)phenyl]cyclohexyl]-5,7,8-trifluoro-1,2,3,4-tetrahydronaphthalene |
| SMILES | CCCCc1ccc(CCC2CCc3c(F)c(C4CCC(c5ccc(OC(F)(F)F)c(F)c5F)CC4)c(F)c(F)c3C2)c(F)c1F |
| InChI | InChI=1S/C35H34F10O/c1-2-3-4-21-12-13-22(29(37)28(21)36)7-5-18-6-14-24-25(17-18)32(40)34(42)27(30(24)38)20-10-8-19(9-11-20)23-15-16-26(33(41)31(23)39)46-35(43,44)45/h12-13,15-16,18-20H,2-11,14,17H2,1H3 |
| InChIKey | WLSPQMLZBNQUMN-UHFFFAOYSA-N |
| XLogP | 11.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.64 |
| LogP ≤ 5 | 11.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|