C35H34F7N — CID 139852200
4-[4-[6-[2-(4-butyl-2,3-difluorophenyl)ethyl]-1,3,4-trifluoro-5,6,7,8-tetrahydronaphthalen-2-yl]cyclohexyl]-2,3-difluorobenzonitrile (PubChem CID 139852200) has the molecular formula C35H34F7N and a molecular weight of 601.65 g/mol. Its IUPAC name is 4-[4-[6-[2-(4-butyl-2,3-difluorophenyl)ethyl]-1,3,4-trifluoro-5,6,7,8-tetrahydronaphthalen-2-yl]cyclohexyl]-2,3-difluorobenzonitrile.
| Compound Name | 4-[4-[6-[2-(4-butyl-2,3-difluorophenyl)ethyl]-1,3,4-trifluoro-5,6,7,8-tetrahydronaphthalen-2-yl]cyclohexyl]-2,3-difluorobenzonitrile |
|---|---|
| PubChem CID | 139852200 |
| Molecular Formula | C35H34F7N |
| Molecular Weight | 601.65 g/mol |
| Exact Mass | 601.26 |
| IUPAC Name | 4-[4-[6-[2-(4-butyl-2,3-difluorophenyl)ethyl]-1,3,4-trifluoro-5,6,7,8-tetrahydronaphthalen-2-yl]cyclohexyl]-2,3-difluorobenzonitrile |
| SMILES | CCCCc1ccc(CCC2CCc3c(F)c(C4CCC(c5ccc(C#N)c(F)c5F)CC4)c(F)c(F)c3C2)c(F)c1F |
| InChI | InChI=1S/C35H34F7N/c1-2-3-4-22-12-13-23(30(37)29(22)36)7-5-19-6-15-26-27(17-19)34(41)35(42)28(32(26)39)21-10-8-20(9-11-21)25-16-14-24(18-43)31(38)33(25)40/h12-14,16,19-21H,2-11,15,17H2,1H3 |
| InChIKey | HEGIINVEEKWIRX-UHFFFAOYSA-N |
| XLogP | 10.05 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.65 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|