C36H37F6N — CID 139853438
4-[4-[6-[2-(2,6-difluoro-4-pentylphenyl)ethyl]-1,3,4-trifluoro-5,6,7,8-tetrahydronaphthalen-2-yl]cyclohexyl]-2-fluorobenzonitrile (PubChem CID 139853438) has the molecular formula C36H37F6N and a molecular weight of 597.69 g/mol. Its IUPAC name is 4-[4-[6-[2-(2,6-difluoro-4-pentylphenyl)ethyl]-1,3,4-trifluoro-5,6,7,8-tetrahydronaphthalen-2-yl]cyclohexyl]-2-fluorobenzonitrile.
| Compound Name | 4-[4-[6-[2-(2,6-difluoro-4-pentylphenyl)ethyl]-1,3,4-trifluoro-5,6,7,8-tetrahydronaphthalen-2-yl]cyclohexyl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 139853438 |
| Molecular Formula | C36H37F6N |
| Molecular Weight | 597.69 g/mol |
| Exact Mass | 597.28 |
| IUPAC Name | 4-[4-[6-[2-(2,6-difluoro-4-pentylphenyl)ethyl]-1,3,4-trifluoro-5,6,7,8-tetrahydronaphthalen-2-yl]cyclohexyl]-2-fluorobenzonitrile |
| SMILES | CCCCCc1cc(F)c(CCC2CCc3c(F)c(C4CCC(c5ccc(C#N)c(F)c5)CC4)c(F)c(F)c3C2)c(F)c1 |
| InChI | InChI=1S/C36H37F6N/c1-2-3-4-5-22-17-31(38)28(32(39)18-22)15-7-21-6-14-27-29(16-21)35(41)36(42)33(34(27)40)24-10-8-23(9-11-24)25-12-13-26(20-43)30(37)19-25/h12-13,17-19,21,23-24H,2-11,14-16H2,1H3 |
| InChIKey | SHZGGKHHJHUWMB-UHFFFAOYSA-N |
| XLogP | 10.30 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.69 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|