C24H27F5O — CID 19366440
2-fluoro-1-[2-[3-fluoro-4-(trifluoromethoxy)phenyl]ethyl]-4-(4-propylcyclohexyl)benzene (PubChem CID 19366440) has the molecular formula C24H27F5O and a molecular weight of 426.47 g/mol. Its IUPAC name is 2-fluoro-1-[2-[3-fluoro-4-(trifluoromethoxy)phenyl]ethyl]-4-(4-propylcyclohexyl)benzene.
| Compound Name | 2-fluoro-1-[2-[3-fluoro-4-(trifluoromethoxy)phenyl]ethyl]-4-(4-propylcyclohexyl)benzene |
|---|---|
| PubChem CID | 19366440 |
| Molecular Formula | C24H27F5O |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | 2-fluoro-1-[2-[3-fluoro-4-(trifluoromethoxy)phenyl]ethyl]-4-(4-propylcyclohexyl)benzene |
| SMILES | CCCC1CCC(c2ccc(CCc3ccc(OC(F)(F)F)c(F)c3)c(F)c2)CC1 |
| InChI | InChI=1S/C24H27F5O/c1-2-3-16-4-8-18(9-5-16)20-12-11-19(21(25)15-20)10-6-17-7-13-23(22(26)14-17)30-24(27,28)29/h7,11-16,18H,2-6,8-10H2,1H3 |
| InChIKey | SJJVINCTDPGIRV-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |