C24H28F4O — CID 139748632
4-[[4-(4-butylcyclohexyl)phenyl]methyl]-2-fluoro-1-(trifluoromethoxy)benzene (PubChem CID 139748632) has the molecular formula C24H28F4O and a molecular weight of 408.48 g/mol. Its IUPAC name is 4-[[4-(4-butylcyclohexyl)phenyl]methyl]-2-fluoro-1-(trifluoromethoxy)benzene.
| Compound Name | 4-[[4-(4-butylcyclohexyl)phenyl]methyl]-2-fluoro-1-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 139748632 |
| Molecular Formula | C24H28F4O |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | 4-[[4-(4-butylcyclohexyl)phenyl]methyl]-2-fluoro-1-(trifluoromethoxy)benzene |
| SMILES | CCCCC1CCC(c2ccc(Cc3ccc(OC(F)(F)F)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C24H28F4O/c1-2-3-4-17-5-10-20(11-6-17)21-12-7-18(8-13-21)15-19-9-14-23(22(25)16-19)29-24(26,27)28/h7-9,12-14,16-17,20H,2-6,10-11,15H2,1H3 |
| InChIKey | GTBWUAMYPVLGPG-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |