C22H27F2N — CID 58840013
2,6-difluoro-4-(6-pentyl-1,2,3,4,5,6,7,8-octahydronaphthalen-2-yl)benzonitrile (PubChem CID 58840013) has the molecular formula C22H27F2N and a molecular weight of 343.46 g/mol. Its IUPAC name is 2,6-difluoro-4-(6-pentyl-1,2,3,4,5,6,7,8-octahydronaphthalen-2-yl)benzonitrile.
| Compound Name | 2,6-difluoro-4-(6-pentyl-1,2,3,4,5,6,7,8-octahydronaphthalen-2-yl)benzonitrile |
|---|---|
| PubChem CID | 58840013 |
| Molecular Formula | C22H27F2N |
| Molecular Weight | 343.46 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | 2,6-difluoro-4-(6-pentyl-1,2,3,4,5,6,7,8-octahydronaphthalen-2-yl)benzonitrile |
| SMILES | CCCCCC1CCC2=C(CCC(c3cc(F)c(C#N)c(F)c3)C2)C1 |
| InChI | InChI=1S/C22H27F2N/c1-2-3-4-5-15-6-7-17-11-18(9-8-16(17)10-15)19-12-21(23)20(14-25)22(24)13-19/h12-13,15,18H,2-11H2,1H3 |
| InChIKey | XWEJLHNMYMFBNH-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.46 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|