C21H24FN — CID 58839635
4-(6-but-3-enyl-1,2,3,4,5,6,7,8-octahydronaphthalen-2-yl)-2-fluorobenzonitrile (PubChem CID 58839635) has the molecular formula C21H24FN and a molecular weight of 309.43 g/mol. Its IUPAC name is 4-(6-but-3-enyl-1,2,3,4,5,6,7,8-octahydronaphthalen-2-yl)-2-fluorobenzonitrile.
| Compound Name | 4-(6-but-3-enyl-1,2,3,4,5,6,7,8-octahydronaphthalen-2-yl)-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 58839635 |
| Molecular Formula | C21H24FN |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | 4-(6-but-3-enyl-1,2,3,4,5,6,7,8-octahydronaphthalen-2-yl)-2-fluorobenzonitrile |
| SMILES | C=CCCC1CCC2=C(CCC(c3ccc(C#N)c(F)c3)C2)C1 |
| InChI | InChI=1S/C21H24FN/c1-2-3-4-15-5-6-17-12-18(8-7-16(17)11-15)19-9-10-20(14-23)21(22)13-19/h2,9-10,13,15,18H,1,3-8,11-12H2 |
| InChIKey | BMYBFGGBUMFAOT-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|