C25H26F4 — CID 22045227
2-but-3-enyl-7-[3-fluoro-4-(trifluoromethyl)phenyl]-1,2,3,4,5,6,7,8-octahydrophenanthrene (PubChem CID 22045227) has the molecular formula C25H26F4 and a molecular weight of 402.48 g/mol. Its IUPAC name is 2-but-3-enyl-7-[3-fluoro-4-(trifluoromethyl)phenyl]-1,2,3,4,5,6,7,8-octahydrophenanthrene.
| Compound Name | 2-but-3-enyl-7-[3-fluoro-4-(trifluoromethyl)phenyl]-1,2,3,4,5,6,7,8-octahydrophenanthrene |
|---|---|
| PubChem CID | 22045227 |
| Molecular Formula | C25H26F4 |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | 2-but-3-enyl-7-[3-fluoro-4-(trifluoromethyl)phenyl]-1,2,3,4,5,6,7,8-octahydrophenanthrene |
| SMILES | C=CCCC1CCc2c(ccc3c2CCC(c2ccc(C(F)(F)F)c(F)c2)C3)C1 |
| InChI | InChI=1S/C25H26F4/c1-2-3-4-16-5-10-21-19(13-16)6-7-20-14-17(8-11-22(20)21)18-9-12-23(24(26)15-18)25(27,28)29/h2,6-7,9,12,15-17H,1,3-5,8,10-11,13-14H2 |
| InChIKey | MZDXXBVQGSBUJO-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|