C26H28F4O — CID 22045098
2-[3-fluoro-4-(trifluoromethoxy)phenyl]-7-[(E)-pent-3-enyl]-1,2,3,4,5,6,7,8-octahydrophenanthrene (PubChem CID 22045098) has the molecular formula C26H28F4O and a molecular weight of 432.50 g/mol. Its IUPAC name is 2-[3-fluoro-4-(trifluoromethoxy)phenyl]-7-[(E)-pent-3-enyl]-1,2,3,4,5,6,7,8-octahydrophenanthrene.
| Compound Name | 2-[3-fluoro-4-(trifluoromethoxy)phenyl]-7-[(E)-pent-3-enyl]-1,2,3,4,5,6,7,8-octahydrophenanthrene |
|---|---|
| PubChem CID | 22045098 |
| Molecular Formula | C26H28F4O |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | 2-[3-fluoro-4-(trifluoromethoxy)phenyl]-7-[(E)-pent-3-enyl]-1,2,3,4,5,6,7,8-octahydrophenanthrene |
| SMILES | C/C=C/CCC1CCc2c(ccc3c2CCC(c2ccc(OC(F)(F)F)c(F)c2)C3)C1 |
| InChI | InChI=1S/C26H28F4O/c1-2-3-4-5-17-6-11-22-20(14-17)7-8-21-15-18(9-12-23(21)22)19-10-13-25(24(27)16-19)31-26(28,29)30/h2-3,7-8,10,13,16-18H,4-6,9,11-12,14-15H2,1H3/b3-2+ |
| InChIKey | QKBDKHAVZSREEF-NSCUHMNNSA-N |
| XLogP | 7.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|