C24H25F3O — CID 22045203
2-[(E)-prop-1-enyl]-7-[4-(trifluoromethoxy)phenyl]-1,2,3,4,5,6,7,8-octahydrophenanthrene (PubChem CID 22045203) has the molecular formula C24H25F3O and a molecular weight of 386.46 g/mol. Its IUPAC name is 2-[(E)-prop-1-enyl]-7-[4-(trifluoromethoxy)phenyl]-1,2,3,4,5,6,7,8-octahydrophenanthrene.
| Compound Name | 2-[(E)-prop-1-enyl]-7-[4-(trifluoromethoxy)phenyl]-1,2,3,4,5,6,7,8-octahydrophenanthrene |
|---|---|
| PubChem CID | 22045203 |
| Molecular Formula | C24H25F3O |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 2-[(E)-prop-1-enyl]-7-[4-(trifluoromethoxy)phenyl]-1,2,3,4,5,6,7,8-octahydrophenanthrene |
| SMILES | C/C=C/C1CCc2c(ccc3c2CCC(c2ccc(OC(F)(F)F)cc2)C3)C1 |
| InChI | InChI=1S/C24H25F3O/c1-2-3-16-4-12-22-19(14-16)5-6-20-15-18(9-13-23(20)22)17-7-10-21(11-8-17)28-24(25,26)27/h2-3,5-8,10-11,16,18H,4,9,12-15H2,1H3/b3-2+ |
| InChIKey | NKEXZKOJRCMOKX-NSCUHMNNSA-N |
| XLogP | 6.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|