C21H20ClF3O — CID 54491632
1-[4-(2-chloroethenyl)cyclohexyl]-4-[4-(trifluoromethoxy)phenyl]benzene (PubChem CID 54491632) has the molecular formula C21H20ClF3O and a molecular weight of 380.84 g/mol. Its IUPAC name is 1-[4-(2-chloroethenyl)cyclohexyl]-4-[4-(trifluoromethoxy)phenyl]benzene.
| Compound Name | 1-[4-(2-chloroethenyl)cyclohexyl]-4-[4-(trifluoromethoxy)phenyl]benzene |
|---|---|
| PubChem CID | 54491632 |
| Molecular Formula | C21H20ClF3O |
| Molecular Weight | 380.84 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 1-[4-(2-chloroethenyl)cyclohexyl]-4-[4-(trifluoromethoxy)phenyl]benzene |
| SMILES | FC(F)(F)Oc1ccc(-c2ccc(C3CCC(C=CCl)CC3)cc2)cc1 |
| InChI | InChI=1S/C21H20ClF3O/c22-14-13-15-1-3-16(4-2-15)17-5-7-18(8-6-17)19-9-11-20(12-10-19)26-21(23,24)25/h5-16H,1-4H2 |
| InChIKey | XWDFIIUMAXSKJK-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.84 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |