C25H25F3O — CID 18657401
1-ethyl-4-[4-[(E)-4-[4-(trifluoromethoxy)phenyl]but-1-en-3-ynyl]cyclohexyl]benzene (PubChem CID 18657401) has the molecular formula C25H25F3O and a molecular weight of 398.47 g/mol. Its IUPAC name is 1-ethyl-4-[4-[(E)-4-[4-(trifluoromethoxy)phenyl]but-1-en-3-ynyl]cyclohexyl]benzene.
| Compound Name | 1-ethyl-4-[4-[(E)-4-[4-(trifluoromethoxy)phenyl]but-1-en-3-ynyl]cyclohexyl]benzene |
|---|---|
| PubChem CID | 18657401 |
| Molecular Formula | C25H25F3O |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 1-ethyl-4-[4-[(E)-4-[4-(trifluoromethoxy)phenyl]but-1-en-3-ynyl]cyclohexyl]benzene |
| SMILES | CCc1ccc(C2CCC(/C=C/C#Cc3ccc(OC(F)(F)F)cc3)CC2)cc1 |
| InChI | InChI=1S/C25H25F3O/c1-2-19-7-13-22(14-8-19)23-15-9-20(10-16-23)5-3-4-6-21-11-17-24(18-12-21)29-25(26,27)28/h3,5,7-8,11-14,17-18,20,23H,2,9-10,15-16H2,1H3/b5-3+ |
| InChIKey | ZAKLVNUTLOHFSD-HWKANZROSA-N |
| XLogP | 7.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|