C23H23F3O — CID 67864736
1-(4-ethylcyclohexyl)-4-[2-[4-(trifluoromethoxy)phenyl]ethynyl]benzene (PubChem CID 67864736) has the molecular formula C23H23F3O and a molecular weight of 372.43 g/mol. Its IUPAC name is 1-(4-ethylcyclohexyl)-4-[2-[4-(trifluoromethoxy)phenyl]ethynyl]benzene.
| Compound Name | 1-(4-ethylcyclohexyl)-4-[2-[4-(trifluoromethoxy)phenyl]ethynyl]benzene |
|---|---|
| PubChem CID | 67864736 |
| Molecular Formula | C23H23F3O |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 1-(4-ethylcyclohexyl)-4-[2-[4-(trifluoromethoxy)phenyl]ethynyl]benzene |
| SMILES | CCC1CCC(c2ccc(C#Cc3ccc(OC(F)(F)F)cc3)cc2)CC1 |
| InChI | InChI=1S/C23H23F3O/c1-2-17-5-11-20(12-6-17)21-13-7-18(8-14-21)3-4-19-9-15-22(16-10-19)27-23(24,25)26/h7-10,13-17,20H,2,5-6,11-12H2,1H3 |
| InChIKey | OTQFHLKLCKTPHR-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|