C19H21F3O — CID 54231732
1-[4-(4-ethylcyclohexyl)but-3-en-1-ynyl]-4-(trifluoromethoxy)benzene (PubChem CID 54231732) has the molecular formula C19H21F3O and a molecular weight of 322.37 g/mol. Its IUPAC name is 1-[4-(4-ethylcyclohexyl)but-3-en-1-ynyl]-4-(trifluoromethoxy)benzene.
| Compound Name | 1-[4-(4-ethylcyclohexyl)but-3-en-1-ynyl]-4-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 54231732 |
| Molecular Formula | C19H21F3O |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 1-[4-(4-ethylcyclohexyl)but-3-en-1-ynyl]-4-(trifluoromethoxy)benzene |
| SMILES | CCC1CCC(C=CC#Cc2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C19H21F3O/c1-2-15-7-9-16(10-8-15)5-3-4-6-17-11-13-18(14-12-17)23-19(20,21)22/h3,5,11-16H,2,7-10H2,1H3 |
| InChIKey | QJTMMEVWXDMZGL-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|