C20H26O — CID 18657244
1-methoxy-4-[(E)-4-(4-propylcyclohexyl)but-3-en-1-ynyl]benzene (PubChem CID 18657244) has the molecular formula C20H26O and a molecular weight of 282.43 g/mol. Its IUPAC name is 1-methoxy-4-[(E)-4-(4-propylcyclohexyl)but-3-en-1-ynyl]benzene.
| Compound Name | 1-methoxy-4-[(E)-4-(4-propylcyclohexyl)but-3-en-1-ynyl]benzene |
|---|---|
| PubChem CID | 18657244 |
| Molecular Formula | C20H26O |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | 1-methoxy-4-[(E)-4-(4-propylcyclohexyl)but-3-en-1-ynyl]benzene |
| SMILES | CCCC1CCC(/C=C/C#Cc2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C20H26O/c1-3-6-17-9-11-18(12-10-17)7-4-5-8-19-13-15-20(21-2)16-14-19/h4,7,13-18H,3,6,9-12H2,1-2H3/b7-4+ |
| InChIKey | RANMDUIOFWAAOR-QPJJXVBHSA-N |
| XLogP | 5.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|