C23H28O — CID 19425017
1-ethoxy-4-[(E)-6-(4-propylcyclohexyl)hex-3-en-1,5-diynyl]benzene (PubChem CID 19425017) has the molecular formula C23H28O and a molecular weight of 320.48 g/mol. Its IUPAC name is 1-ethoxy-4-[(E)-6-(4-propylcyclohexyl)hex-3-en-1,5-diynyl]benzene.
| Compound Name | 1-ethoxy-4-[(E)-6-(4-propylcyclohexyl)hex-3-en-1,5-diynyl]benzene |
|---|---|
| PubChem CID | 19425017 |
| Molecular Formula | C23H28O |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | 1-ethoxy-4-[(E)-6-(4-propylcyclohexyl)hex-3-en-1,5-diynyl]benzene |
| SMILES | CCCC1CCC(C#C/C=C/C#Cc2ccc(OCC)cc2)CC1 |
| InChI | InChI=1S/C23H28O/c1-3-9-20-12-14-21(15-13-20)10-7-5-6-8-11-22-16-18-23(19-17-22)24-4-2/h5-6,16-21H,3-4,9,12-15H2,1-2H3/b6-5+ |
| InChIKey | OCPCWPMAQFGETM-AATRIKPKSA-N |
| XLogP | 5.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|