C24H36 — CID 19424873
1-propyl-4-[(E)-6-(4-propylcyclohexyl)hex-3-en-1,5-diynyl]cyclohexane (PubChem CID 19424873) has the molecular formula C24H36 and a molecular weight of 324.55 g/mol. Its IUPAC name is 1-propyl-4-[(E)-6-(4-propylcyclohexyl)hex-3-en-1,5-diynyl]cyclohexane.
| Compound Name | 1-propyl-4-[(E)-6-(4-propylcyclohexyl)hex-3-en-1,5-diynyl]cyclohexane |
|---|---|
| PubChem CID | 19424873 |
| Molecular Formula | C24H36 |
| Molecular Weight | 324.55 g/mol |
| Exact Mass | 324.28 |
| IUPAC Name | 1-propyl-4-[(E)-6-(4-propylcyclohexyl)hex-3-en-1,5-diynyl]cyclohexane |
| SMILES | CCCC1CCC(C#C/C=C/C#CC2CCC(CCC)CC2)CC1 |
| InChI | InChI=1S/C24H36/c1-3-9-21-13-17-23(18-14-21)11-7-5-6-8-12-24-19-15-22(10-4-2)16-20-24/h5-6,21-24H,3-4,9-10,13-20H2,1-2H3/b6-5+ |
| InChIKey | QCOYKWUZEOZBQN-AATRIKPKSA-N |
| XLogP | 6.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.55 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|