C23H28 — CID 19424964
1-[(E)-6-(4-ethylcyclohexyl)hex-3-en-1,5-diynyl]-4-propylbenzene (PubChem CID 19424964) has the molecular formula C23H28 and a molecular weight of 304.48 g/mol. Its IUPAC name is 1-[(E)-6-(4-ethylcyclohexyl)hex-3-en-1,5-diynyl]-4-propylbenzene.
| Compound Name | 1-[(E)-6-(4-ethylcyclohexyl)hex-3-en-1,5-diynyl]-4-propylbenzene |
|---|---|
| PubChem CID | 19424964 |
| Molecular Formula | C23H28 |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 1-[(E)-6-(4-ethylcyclohexyl)hex-3-en-1,5-diynyl]-4-propylbenzene |
| SMILES | CCCc1ccc(C#C/C=C/C#CC2CCC(CC)CC2)cc1 |
| InChI | InChI=1S/C23H28/c1-3-9-21-16-18-23(19-17-21)11-8-6-5-7-10-22-14-12-20(4-2)13-15-22/h5-6,16-20,22H,3-4,9,12-15H2,1-2H3/b6-5+ |
| InChIKey | LMXOXCIFCKCFJL-AATRIKPKSA-N |
| XLogP | 5.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|