C27H38O — CID 18657203
1-ethoxy-4-[(E)-4-[4-(4-propylcyclohexyl)cyclohexyl]but-3-en-1-ynyl]benzene (PubChem CID 18657203) has the molecular formula C27H38O and a molecular weight of 378.60 g/mol. Its IUPAC name is 1-ethoxy-4-[(E)-4-[4-(4-propylcyclohexyl)cyclohexyl]but-3-en-1-ynyl]benzene.
| Compound Name | 1-ethoxy-4-[(E)-4-[4-(4-propylcyclohexyl)cyclohexyl]but-3-en-1-ynyl]benzene |
|---|---|
| PubChem CID | 18657203 |
| Molecular Formula | C27H38O |
| Molecular Weight | 378.60 g/mol |
| Exact Mass | 378.29 |
| IUPAC Name | 1-ethoxy-4-[(E)-4-[4-(4-propylcyclohexyl)cyclohexyl]but-3-en-1-ynyl]benzene |
| SMILES | CCCC1CCC(C2CCC(/C=C/C#Cc3ccc(OCC)cc3)CC2)CC1 |
| InChI | InChI=1S/C27H38O/c1-3-7-22-10-16-25(17-11-22)26-18-12-23(13-19-26)8-5-6-9-24-14-20-27(21-15-24)28-4-2/h5,8,14-15,20-23,25-26H,3-4,7,10-13,16-19H2,1-2H3/b8-5+ |
| InChIKey | RDSFCDUTRQXNGR-VMPITWQZSA-N |
| XLogP | 7.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.60 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|