C22H30O — CID 54552723
1-butoxy-4-[4-(4-ethylcyclohexyl)but-3-en-1-ynyl]benzene (PubChem CID 54552723) has the molecular formula C22H30O and a molecular weight of 310.48 g/mol. Its IUPAC name is 1-butoxy-4-[4-(4-ethylcyclohexyl)but-3-en-1-ynyl]benzene.
| Compound Name | 1-butoxy-4-[4-(4-ethylcyclohexyl)but-3-en-1-ynyl]benzene |
|---|---|
| PubChem CID | 54552723 |
| Molecular Formula | C22H30O |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | 1-butoxy-4-[4-(4-ethylcyclohexyl)but-3-en-1-ynyl]benzene |
| SMILES | CCCCOc1ccc(C#CC=CC2CCC(CC)CC2)cc1 |
| InChI | InChI=1S/C22H30O/c1-3-5-18-23-22-16-14-21(15-17-22)9-7-6-8-20-12-10-19(4-2)11-13-20/h6,8,14-17,19-20H,3-5,10-13,18H2,1-2H3 |
| InChIKey | ZLAWZSLGJKONEM-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|