C27H32O — CID 18657214
1-ethyl-4-[(E)-4-[4-(4-propoxyphenyl)cyclohexyl]but-3-en-1-ynyl]benzene (PubChem CID 18657214) has the molecular formula C27H32O and a molecular weight of 372.55 g/mol. Its IUPAC name is 1-ethyl-4-[(E)-4-[4-(4-propoxyphenyl)cyclohexyl]but-3-en-1-ynyl]benzene.
| Compound Name | 1-ethyl-4-[(E)-4-[4-(4-propoxyphenyl)cyclohexyl]but-3-en-1-ynyl]benzene |
|---|---|
| PubChem CID | 18657214 |
| Molecular Formula | C27H32O |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | 1-ethyl-4-[(E)-4-[4-(4-propoxyphenyl)cyclohexyl]but-3-en-1-ynyl]benzene |
| SMILES | CCCOc1ccc(C2CCC(/C=C/C#Cc3ccc(CC)cc3)CC2)cc1 |
| InChI | InChI=1S/C27H32O/c1-3-21-28-27-19-17-26(18-20-27)25-15-13-24(14-16-25)8-6-5-7-23-11-9-22(4-2)10-12-23/h6,8-12,17-20,24-25H,3-4,13-16,21H2,1-2H3/b8-6+ |
| InChIKey | XALKXEAKGWQTSI-SOFGYWHQSA-N |
| XLogP | 6.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|