C23H22O — CID 19424940
1-ethyl-4-[(E)-6-(4-propoxyphenyl)hex-3-en-1,5-diynyl]benzene (PubChem CID 19424940) has the molecular formula C23H22O and a molecular weight of 314.43 g/mol. Its IUPAC name is 1-ethyl-4-[(E)-6-(4-propoxyphenyl)hex-3-en-1,5-diynyl]benzene.
| Compound Name | 1-ethyl-4-[(E)-6-(4-propoxyphenyl)hex-3-en-1,5-diynyl]benzene |
|---|---|
| PubChem CID | 19424940 |
| Molecular Formula | C23H22O |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 1-ethyl-4-[(E)-6-(4-propoxyphenyl)hex-3-en-1,5-diynyl]benzene |
| SMILES | CCCOc1ccc(C#C/C=C/C#Cc2ccc(CC)cc2)cc1 |
| InChI | InChI=1S/C23H22O/c1-3-19-24-23-17-15-22(16-18-23)10-8-6-5-7-9-21-13-11-20(4-2)12-14-21/h5-6,11-18H,3-4,19H2,1-2H3/b6-5+ |
| InChIKey | LDOQPOZPCKPETC-AATRIKPKSA-N |
| XLogP | 5.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|