C21H22O — CID 139767186
1-but-3-enyl-4-[2-(4-propoxyphenyl)ethynyl]benzene (PubChem CID 139767186) has the molecular formula C21H22O and a molecular weight of 290.41 g/mol. Its IUPAC name is 1-but-3-enyl-4-[2-(4-propoxyphenyl)ethynyl]benzene.
| Compound Name | 1-but-3-enyl-4-[2-(4-propoxyphenyl)ethynyl]benzene |
|---|---|
| PubChem CID | 139767186 |
| Molecular Formula | C21H22O |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 1-but-3-enyl-4-[2-(4-propoxyphenyl)ethynyl]benzene |
| SMILES | C=CCCc1ccc(C#Cc2ccc(OCCC)cc2)cc1 |
| InChI | InChI=1S/C21H22O/c1-3-5-6-18-7-9-19(10-8-18)11-12-20-13-15-21(16-14-20)22-17-4-2/h3,7-10,13-16H,1,4-6,17H2,2H3 |
| InChIKey | CWCSYRNDRIALCK-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|