C22H23FO — CID 139767128
2-fluoro-1-[2-(4-pent-4-enylphenyl)ethynyl]-4-propoxybenzene (PubChem CID 139767128) has the molecular formula C22H23FO and a molecular weight of 322.42 g/mol. Its IUPAC name is 2-fluoro-1-[2-(4-pent-4-enylphenyl)ethynyl]-4-propoxybenzene.
| Compound Name | 2-fluoro-1-[2-(4-pent-4-enylphenyl)ethynyl]-4-propoxybenzene |
|---|---|
| PubChem CID | 139767128 |
| Molecular Formula | C22H23FO |
| Molecular Weight | 322.42 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 2-fluoro-1-[2-(4-pent-4-enylphenyl)ethynyl]-4-propoxybenzene |
| SMILES | C=CCCCc1ccc(C#Cc2ccc(OCCC)cc2F)cc1 |
| InChI | InChI=1S/C22H23FO/c1-3-5-6-7-18-8-10-19(11-9-18)12-13-20-14-15-21(17-22(20)23)24-16-4-2/h3,8-11,14-15,17H,1,4-7,16H2,2H3 |
| InChIKey | ZQGPWTXNWBLZDT-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.42 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|