C30H30FNO2 — CID 134376473
1-[2-[4-[2-(4-but-3-enylphenyl)ethyl]phenyl]ethynyl]-4-butoxy-5-fluoro-2-nitrosobenzene (PubChem CID 134376473) has the molecular formula C30H30FNO2 and a molecular weight of 455.57 g/mol. Its IUPAC name is 1-[2-[4-[2-(4-but-3-enylphenyl)ethyl]phenyl]ethynyl]-4-butoxy-5-fluoro-2-nitrosobenzene.
| Compound Name | 1-[2-[4-[2-(4-but-3-enylphenyl)ethyl]phenyl]ethynyl]-4-butoxy-5-fluoro-2-nitrosobenzene |
|---|---|
| PubChem CID | 134376473 |
| Molecular Formula | C30H30FNO2 |
| Molecular Weight | 455.57 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | 1-[2-[4-[2-(4-but-3-enylphenyl)ethyl]phenyl]ethynyl]-4-butoxy-5-fluoro-2-nitrosobenzene |
| SMILES | C=CCCc1ccc(CCc2ccc(C#Cc3cc(F)c(OCCCC)cc3N=O)cc2)cc1 |
| InChI | InChI=1S/C30H30FNO2/c1-3-5-7-23-8-10-24(11-9-23)12-13-25-14-16-26(17-15-25)18-19-27-21-28(31)30(22-29(27)32-33)34-20-6-4-2/h3,8-11,14-17,21-22H,1,4-7,12-13,20H2,2H3 |
| InChIKey | AMMYUNUSCBOOAR-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.57 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|