C24H18F2 — CID 139799047
4-[4-[2-(4-but-3-enylphenyl)ethynyl]phenyl]-1,2-difluorobenzene (PubChem CID 139799047) has the molecular formula C24H18F2 and a molecular weight of 344.40 g/mol. Its IUPAC name is 4-[4-[2-(4-but-3-enylphenyl)ethynyl]phenyl]-1,2-difluorobenzene.
| Compound Name | 4-[4-[2-(4-but-3-enylphenyl)ethynyl]phenyl]-1,2-difluorobenzene |
|---|---|
| PubChem CID | 139799047 |
| Molecular Formula | C24H18F2 |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 4-[4-[2-(4-but-3-enylphenyl)ethynyl]phenyl]-1,2-difluorobenzene |
| SMILES | C=CCCc1ccc(C#Cc2ccc(-c3ccc(F)c(F)c3)cc2)cc1 |
| InChI | InChI=1S/C24H18F2/c1-2-3-4-18-5-7-19(8-6-18)9-10-20-11-13-21(14-12-20)22-15-16-23(25)24(26)17-22/h2,5-8,11-17H,1,3-4H2 |
| InChIKey | XGVIAHDYQJLVNG-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|