C26H22F2 — CID 67683002
5-but-3-enyl-2-[2-[4-(4-ethylphenyl)phenyl]ethynyl]-1,3-difluorobenzene (PubChem CID 67683002) has the molecular formula C26H22F2 and a molecular weight of 372.46 g/mol. Its IUPAC name is 5-but-3-enyl-2-[2-[4-(4-ethylphenyl)phenyl]ethynyl]-1,3-difluorobenzene.
| Compound Name | 5-but-3-enyl-2-[2-[4-(4-ethylphenyl)phenyl]ethynyl]-1,3-difluorobenzene |
|---|---|
| PubChem CID | 67683002 |
| Molecular Formula | C26H22F2 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 5-but-3-enyl-2-[2-[4-(4-ethylphenyl)phenyl]ethynyl]-1,3-difluorobenzene |
| SMILES | C=CCCc1cc(F)c(C#Cc2ccc(-c3ccc(CC)cc3)cc2)c(F)c1 |
| InChI | InChI=1S/C26H22F2/c1-3-5-6-21-17-25(27)24(26(28)18-21)16-11-20-9-14-23(15-10-20)22-12-7-19(4-2)8-13-22/h3,7-10,12-15,17-18H,1,4-6H2,2H3 |
| InChIKey | IAWBYJNOHUGZCM-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|